C72H51N9O9 — CID 158489220
2-[[3-(1-methyltriazol-4-yl)phenoxy]methyl]anthracene-9,10-dione (PubChem CID 158489220) has the molecular formula C72H51N9O9 and a molecular weight of 1186.25 g/mol. Its IUPAC name is 2-[[3-(1-methyltriazol-4-yl)phenoxy]methyl]anthracene-9,10-dione.
| Compound Name | 2-[[3-(1-methyltriazol-4-yl)phenoxy]methyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 158489220 |
| Molecular Formula | C72H51N9O9 |
| Molecular Weight | 1186.25 g/mol |
| Exact Mass | 1185.38 |
| IUPAC Name | 2-[[3-(1-methyltriazol-4-yl)phenoxy]methyl]anthracene-9,10-dione |
| SMILES | Cn1cc(-c2cccc(OCc3ccc4c(c3)C(=O)c3ccccc3C4=O)c2)nn1.Cn1cc(-c2cccc(OCc3ccc4c(c3)C(=O)c3ccccc3C4=O)c2)nn1.Cn1cc(-c2cccc(OCc3ccc4c(c3)C(=O)c3ccccc3C4=O)c2)nn1 |
| InChI | InChI=1S/3C24H17N3O3/c3*1-27-13-22(25-26-27)16-5-4-6-17(12-16)30-14-15-9-10-20-21(11-15)24(29)19-8-3-2-7-18(19)23(20)28/h3*2-13H,14H2,1H3 |
| InChIKey | HIMIBYBPKOGMSJ-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 222.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 90 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1186.25 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|