C23H14N2O4 — CID 102150809
2-[(4-oxo-3H-phthalazin-1-yl)oxymethyl]anthracene-9,10-dione (PubChem CID 102150809) has the molecular formula C23H14N2O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is 2-[(4-oxo-3H-phthalazin-1-yl)oxymethyl]anthracene-9,10-dione.
| Compound Name | 2-[(4-oxo-3H-phthalazin-1-yl)oxymethyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 102150809 |
| Molecular Formula | C23H14N2O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2-[(4-oxo-3H-phthalazin-1-yl)oxymethyl]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2cc(COc3n[nH]c(=O)c4ccccc34)ccc21 |
| InChI | InChI=1S/C23H14N2O4/c26-20-14-5-1-2-6-15(14)21(27)19-11-13(9-10-16(19)20)12-29-23-18-8-4-3-7-17(18)22(28)24-25-23/h1-11H,12H2,(H,24,28) |
| InChIKey | IAEPGYBFFXITSP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|