C11H15NO — CID 158499102
(E)-4,4-dimethyl-1-(3H-pyrrol-2-yl)pent-1-en-3-one (PubChem CID 158499102) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (E)-4,4-dimethyl-1-(3H-pyrrol-2-yl)pent-1-en-3-one.
| Compound Name | (E)-4,4-dimethyl-1-(3H-pyrrol-2-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 158499102 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (E)-4,4-dimethyl-1-(3H-pyrrol-2-yl)pent-1-en-3-one |
| SMILES | CC(C)(C)C(=O)/C=C/C1=NC=CC1 |
| InChI | InChI=1S/C11H15NO/c1-11(2,3)10(13)7-6-9-5-4-8-12-9/h4,6-8H,5H2,1-3H3/b7-6+ |
| InChIKey | HSVGZXUZMFGUOZ-VOTSOKGWSA-N |
| XLogP | 2.52 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|