C9H9N3OS — CID 15850112
5-(4-methylanilino)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 15850112) has the molecular formula C9H9N3OS and a molecular weight of 207.26 g/mol. Its IUPAC name is 5-(4-methylanilino)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(4-methylanilino)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 15850112 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 5-(4-methylanilino)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1ccc(Nc2n[nH]c(=S)o2)cc1 |
| InChI | InChI=1S/C9H9N3OS/c1-6-2-4-7(5-3-6)10-8-11-12-9(14)13-8/h2-5H,1H3,(H,10,11)(H,12,14) |
| InChIKey | JQOCREJVYIRZIO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|