C19H36N3O3+ — CID 158502325
(3S)-3-amino-N-cyclopropyl-2-hydroxyhexanamide;cyclopropyl(methylidyne)azanium;(2S)-2-methylpentanal (PubChem CID 158502325) has the molecular formula C19H36N3O3+ and a molecular weight of 354.52 g/mol. Its IUPAC name is (3S)-3-amino-N-cyclopropyl-2-hydroxyhexanamide;cyclopropyl(methylidyne)azanium;(2S)-2-methylpentanal.
| Compound Name | (3S)-3-amino-N-cyclopropyl-2-hydroxyhexanamide;cyclopropyl(methylidyne)azanium;(2S)-2-methylpentanal |
|---|---|
| PubChem CID | 158502325 |
| Molecular Formula | C19H36N3O3+ |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | (3S)-3-amino-N-cyclopropyl-2-hydroxyhexanamide;cyclopropyl(methylidyne)azanium;(2S)-2-methylpentanal |
| SMILES | C#[N+]C1CC1.CCC[C@H](C)C=O.CCC[C@H](N)C(O)C(=O)NC1CC1 |
| InChI | InChI=1S/C9H18N2O2.C6H12O.C4H6N/c1-2-3-7(10)8(12)9(13)11-6-4-5-6;1-3-4-6(2)5-7;1-5-4-2-3-4/h6-8,12H,2-5,10H2,1H3,(H,11,13);5-6H,3-4H2,1-2H3;1,4H,2-3H2/q;;+1/t7-,8?;6-;/m00./s1 |
| InChIKey | RMMVEKVSKIQEEB-CDZMYNHJSA-N |
| XLogP | 2.49 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|