C33H57N3O2S — CID 158504821
bis(3,5-ditert-butyl-1,2-oxazole);2,5-ditert-butyl-1,3-thiazole (PubChem CID 158504821) has the molecular formula C33H57N3O2S and a molecular weight of 559.91 g/mol. Its IUPAC name is bis(3,5-ditert-butyl-1,2-oxazole);2,5-ditert-butyl-1,3-thiazole.
| Compound Name | bis(3,5-ditert-butyl-1,2-oxazole);2,5-ditert-butyl-1,3-thiazole |
|---|---|
| PubChem CID | 158504821 |
| Molecular Formula | C33H57N3O2S |
| Molecular Weight | 559.91 g/mol |
| Exact Mass | 559.42 |
| IUPAC Name | bis(3,5-ditert-butyl-1,2-oxazole);2,5-ditert-butyl-1,3-thiazole |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)on1.CC(C)(C)c1cc(C(C)(C)C)on1.CC(C)(C)c1cnc(C(C)(C)C)s1 |
| InChI | InChI=1S/2C11H19NO.C11H19NS/c2*1-10(2,3)8-7-9(13-12-8)11(4,5)6;1-10(2,3)8-7-12-9(13-8)11(4,5)6/h3*7H,1-6H3 |
| InChIKey | HKIMGWDHRUGPKF-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.91 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |