C15H21N3O2S — CID 143923976
bis(3,5-dimethyl-1,2-oxazole);2,5-dimethyl-1,3-thiazole (PubChem CID 143923976) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is bis(3,5-dimethyl-1,2-oxazole);2,5-dimethyl-1,3-thiazole.
| Compound Name | bis(3,5-dimethyl-1,2-oxazole);2,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 143923976 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | bis(3,5-dimethyl-1,2-oxazole);2,5-dimethyl-1,3-thiazole |
| SMILES | Cc1cc(C)on1.Cc1cc(C)on1.Cc1cnc(C)s1 |
| InChI | InChI=1S/2C5H7NO.C5H7NS/c2*1-4-3-5(2)7-6-4;1-4-3-6-5(2)7-4/h3*3H,1-2H3 |
| InChIKey | JHLHFEZMMYUXGO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |