About 2-chloroaniline;pyridine
2-chloroaniline;pyridine (PubChem CID 158508942) has the molecular formula C11H11ClN2
and a molecular weight of 206.68 g/mol. Its IUPAC name is 2-chloroaniline;pyridine.
Molecular Properties
| Compound Name | 2-chloroaniline;pyridine |
| PubChem CID | 158508942 |
| Molecular Formula | C11H11ClN2 |
| Molecular Weight | 206.68 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 2-chloroaniline;pyridine |
| SMILES | Nc1ccccc1Cl.c1ccncc1 |
| InChI | InChI=1S/C6H6ClN.C5H5N/c7-5-3-1-2-4-6(5)8;1-2-4-6-5-3-1/h1-4H,8H2;1-5H |
| InChIKey | HKUSGBMYJFSDNN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.68 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroaniline;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroaniline;pyridine?
The IUPAC name of 2-chloroaniline;pyridine (CID 158508942) is 2-chloroaniline;pyridine.
What is the SMILES notation for 2-chloroaniline;pyridine?
The canonical SMILES for 2-chloroaniline;pyridine is Nc1ccccc1Cl.c1ccncc1.
What is the InChIKey of 2-chloroaniline;pyridine?
The InChIKey is HKUSGBMYJFSDNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN.C5H5N/c7-5-3-1-2-4-6(5)8;1-2-4-6-5-3-1/h1-4H,8H2;1-5H.
What are the key properties of 2-chloroaniline;pyridine?
2-chloroaniline;pyridine has a molecular weight of 206.68 g/mol, XLogP of 3.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroaniline;pyridine is sourced from PubChem (CID 158508942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).