C28H33BO3S — CID 158514754
CID 158514754 (PubChem CID 158514754) has the molecular formula C28H33BO3S and a molecular weight of 460.45 g/mol.
| Compound Name | CID 158514754 |
|---|---|
| PubChem CID | 158514754 |
| Molecular Formula | C28H33BO3S |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | — |
| SMILES | CS.C[C@H](OC(=O)C1[C@H](c2ccccc2)C(CO)[C@H]1c1ccccc1)c1ccccc1.[B]C |
| InChI | InChI=1S/C26H26O3.CH3B.CH4S/c1-18(19-11-5-2-6-12-19)29-26(28)25-23(20-13-7-3-8-14-20)22(17-27)24(25)21-15-9-4-10-16-21;2*1-2/h2-16,18,22-25,27H,17H2,1H3;1H3;2H,1H3/t18-,22?,23+,24+,25?;;/m0../s1 |
| InChIKey | XQXVNSZMXKQNES-GFXRQILISA-N |
| XLogP | 5.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|