C42H58N4O6 — CID 158515076
ethyl 7-tert-butyl-3-(2,3-dihydroxypropyl)-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline-2-carboxylate;ethyl 7-tert-butyl-3-prop-2-enyl-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline-2-carboxylate (PubChem CID 158515076) has the molecular formula C42H58N4O6 and a molecular weight of 714.95 g/mol. Its IUPAC name is ethyl 7-tert-butyl-3-(2,3-dihydroxypropyl)-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline-2-carboxylate;ethyl 7-tert-butyl-3-prop-2-enyl-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline-2-carboxylate.
| Compound Name | ethyl 7-tert-butyl-3-(2,3-dihydroxypropyl)-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline-2-carboxylate;ethyl 7-tert-butyl-3-prop-2-enyl-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 158515076 |
| Molecular Formula | C42H58N4O6 |
| Molecular Weight | 714.95 g/mol |
| Exact Mass | 714.44 |
| IUPAC Name | ethyl 7-tert-butyl-3-(2,3-dihydroxypropyl)-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline-2-carboxylate;ethyl 7-tert-butyl-3-prop-2-enyl-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline-2-carboxylate |
| SMILES | C=CCc1c(C(=O)OCC)[nH]c2cc3c(nc12)CCC(C(C)(C)C)C3.CCOC(=O)c1[nH]c2cc3c(nc2c1CC(O)CO)CCC(C(C)(C)C)C3 |
| InChI | InChI=1S/C21H30N2O4.C21H28N2O2/c1-5-27-20(26)19-15(10-14(25)11-24)18-17(23-19)9-12-8-13(21(2,3)4)6-7-16(12)22-18;1-6-8-15-18-17(23-19(15)20(24)25-7-2)12-13-11-14(21(3,4)5)9-10-16(13)22-18/h9,13-14,23-25H,5-8,10-11H2,1-4H3;6,12,14,23H,1,7-11H2,2-5H3 |
| InChIKey | HLNKGYDYLNGIQZ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 150.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.95 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|