C38H46N4O3 — CID 44626582
methyl 1-[(1R,2R,4R,5Z,12R,13S,16Z)-13-hydroxy-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-25-yl]-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 44626582) has the molecular formula C38H46N4O3 and a molecular weight of 606.81 g/mol. Its IUPAC name is methyl 1-[(1R,2R,4R,5Z,12R,13S,16Z)-13-hydroxy-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-25-yl]-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 1-[(1R,2R,4R,5Z,12R,13S,16Z)-13-hydroxy-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-25-yl]-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 44626582 |
| Molecular Formula | C38H46N4O3 |
| Molecular Weight | 606.81 g/mol |
| Exact Mass | 606.36 |
| IUPAC Name | methyl 1-[(1R,2R,4R,5Z,12R,13S,16Z)-13-hydroxy-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-25-yl]-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)c1cc2c([nH]c3ccccc32)c(C2=C[C@@]3(O)CC/C=C\CCCCN4CC[C@@H]2[C@]2(C[C@@H]5/C=C\CCCCN5[C@H]23)C4)n1 |
| InChI | InChI=1S/C38H46N4O3/c1-45-35(43)32-22-28-27-15-9-10-16-31(27)39-33(28)34(40-32)29-24-38(44)18-11-5-2-3-6-12-19-41-21-17-30(29)37(25-41)23-26-14-8-4-7-13-20-42(26)36(37)38/h2,5,8-10,14-16,22,24,26,30,36,39,44H,3-4,6-7,11-13,17-21,23,25H2,1H3/b5-2-,14-8-/t26-,30-,36+,37-,38-/m0/s1 |
| InChIKey | MHHCPGADKGCAIP-WWMOPDSRSA-N |
| XLogP | 6.64 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.81 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|