C32H24N4O7S2 — CID 158516632
2-[4-[(E)-2-[4-[(4-methylbenzoyl)amino]-2-sulfophenyl]ethenyl]phenyl]benzo[e]benzotriazole-5-sulfonic acid (PubChem CID 158516632) has the molecular formula C32H24N4O7S2 and a molecular weight of 640.70 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-[(4-methylbenzoyl)amino]-2-sulfophenyl]ethenyl]phenyl]benzo[e]benzotriazole-5-sulfonic acid.
| Compound Name | 2-[4-[(E)-2-[4-[(4-methylbenzoyl)amino]-2-sulfophenyl]ethenyl]phenyl]benzo[e]benzotriazole-5-sulfonic acid |
|---|---|
| PubChem CID | 158516632 |
| Molecular Formula | C32H24N4O7S2 |
| Molecular Weight | 640.70 g/mol |
| Exact Mass | 640.11 |
| IUPAC Name | 2-[4-[(E)-2-[4-[(4-methylbenzoyl)amino]-2-sulfophenyl]ethenyl]phenyl]benzo[e]benzotriazole-5-sulfonic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(/C=C/c3ccc(-n4nc5cc(S(=O)(=O)O)c6ccccc6c5n4)cc3)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C32H24N4O7S2/c1-20-6-11-23(12-7-20)32(37)33-24-15-14-22(29(18-24)44(38,39)40)13-8-21-9-16-25(17-10-21)36-34-28-19-30(45(41,42)43)26-4-2-3-5-27(26)31(28)35-36/h2-19H,1H3,(H,33,37)(H,38,39,40)(H,41,42,43)/b13-8+ |
| InChIKey | HXKCILAMSKYEQD-MDWZMJQESA-N |
| XLogP | 5.80 |
| TPSA | 168.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.70 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|