C19H30ClNO3 — CID 15851918
1-[2-chloro-2-(4-methoxyphenyl)ethoxy]-4-methoxy-2,2,6,6-tetramethylpiperidine (PubChem CID 15851918) has the molecular formula C19H30ClNO3 and a molecular weight of 355.91 g/mol. Its IUPAC name is 1-[2-chloro-2-(4-methoxyphenyl)ethoxy]-4-methoxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-[2-chloro-2-(4-methoxyphenyl)ethoxy]-4-methoxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 15851918 |
| Molecular Formula | C19H30ClNO3 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 1-[2-chloro-2-(4-methoxyphenyl)ethoxy]-4-methoxy-2,2,6,6-tetramethylpiperidine |
| SMILES | COc1ccc(C(Cl)CON2C(C)(C)CC(OC)CC2(C)C)cc1 |
| InChI | InChI=1S/C19H30ClNO3/c1-18(2)11-16(23-6)12-19(3,4)21(18)24-13-17(20)14-7-9-15(22-5)10-8-14/h7-10,16-17H,11-13H2,1-6H3 |
| InChIKey | AQPFMTLXVNGICI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|