C24H32N2O4 — CID 158521711
1H-naphthalen-2-one;O-[(8Z)-3-oxa-2-azabicyclo[10.3.1]hexadeca-1,8,12-trien-13-yl]hydroxylamine;hydrate (PubChem CID 158521711) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 1H-naphthalen-2-one;O-[(8Z)-3-oxa-2-azabicyclo[10.3.1]hexadeca-1,8,12-trien-13-yl]hydroxylamine;hydrate.
| Compound Name | 1H-naphthalen-2-one;O-[(8Z)-3-oxa-2-azabicyclo[10.3.1]hexadeca-1,8,12-trien-13-yl]hydroxylamine;hydrate |
|---|---|
| PubChem CID | 158521711 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 1H-naphthalen-2-one;O-[(8Z)-3-oxa-2-azabicyclo[10.3.1]hexadeca-1,8,12-trien-13-yl]hydroxylamine;hydrate |
| SMILES | NOC1=C2CC/C=C/CCCCON=C(CC1)C2.O.O=C1C=Cc2ccccc2C1 |
| InChI | InChI=1S/C14H22N2O2.C10H8O.H2O/c15-18-14-9-8-13-11-12(14)7-5-3-1-2-4-6-10-17-16-13;11-10-6-5-8-3-1-2-4-9(8)7-10;/h1,3H,2,4-11,15H2;1-6H,7H2;1H2/b3-1+,16-13?;; |
| InChIKey | BBYHXZBRXWDJOV-YDAJQYCASA-N |
| XLogP | 4.21 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|