C12H16N4O6 — CID 158525985
N'-naphthalen-1-ylethane-1,2-diamine;bis(nitric acid) (PubChem CID 158525985) has the molecular formula C12H16N4O6 and a molecular weight of 312.28 g/mol. Its IUPAC name is N'-naphthalen-1-ylethane-1,2-diamine;bis(nitric acid).
| Compound Name | N'-naphthalen-1-ylethane-1,2-diamine;bis(nitric acid) |
|---|---|
| PubChem CID | 158525985 |
| Molecular Formula | C12H16N4O6 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N'-naphthalen-1-ylethane-1,2-diamine;bis(nitric acid) |
| SMILES | NCCNc1cccc2ccccc12.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C12H14N2.2HNO3/c13-8-9-14-12-7-3-5-10-4-1-2-6-11(10)12;2*2-1(3)4/h1-7,14H,8-9,13H2;2*(H,2,3,4) |
| InChIKey | HMUAOPPBIZXELH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 164.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|