C18H22ClN3O3S — CID 175085232
4-aminobenzenesulfonic acid;N'-naphthalen-1-ylethane-1,2-diamine;hydrochloride (PubChem CID 175085232) has the molecular formula C18H22ClN3O3S and a molecular weight of 395.91 g/mol. Its IUPAC name is 4-aminobenzenesulfonic acid;N'-naphthalen-1-ylethane-1,2-diamine;hydrochloride.
| Compound Name | 4-aminobenzenesulfonic acid;N'-naphthalen-1-ylethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 175085232 |
| Molecular Formula | C18H22ClN3O3S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 4-aminobenzenesulfonic acid;N'-naphthalen-1-ylethane-1,2-diamine;hydrochloride |
| SMILES | Cl.NCCNc1cccc2ccccc12.Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C12H14N2.C6H7NO3S.ClH/c13-8-9-14-12-7-3-5-10-4-1-2-6-11(10)12;7-5-1-3-6(4-2-5)11(8,9)10;/h1-7,14H,8-9,13H2;1-4H,7H2,(H,8,9,10);1H |
| InChIKey | NCOGIIXVIDJMKL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|