C15H20NO7P — CID 15853140
ethyl 2-cyano-3-dimethoxyphosphoryl-3-(4-hydroxy-3-methoxyphenyl)propanoate (PubChem CID 15853140) has the molecular formula C15H20NO7P and a molecular weight of 357.30 g/mol. Its IUPAC name is ethyl 2-cyano-3-dimethoxyphosphoryl-3-(4-hydroxy-3-methoxyphenyl)propanoate.
| Compound Name | ethyl 2-cyano-3-dimethoxyphosphoryl-3-(4-hydroxy-3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 15853140 |
| Molecular Formula | C15H20NO7P |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | ethyl 2-cyano-3-dimethoxyphosphoryl-3-(4-hydroxy-3-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(C#N)C(c1ccc(O)c(OC)c1)P(=O)(OC)OC |
| InChI | InChI=1S/C15H20NO7P/c1-5-23-15(18)11(9-16)14(24(19,21-3)22-4)10-6-7-12(17)13(8-10)20-2/h6-8,11,14,17H,5H2,1-4H3 |
| InChIKey | WNEAMIIJBROZND-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 115.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|