C37H43BBr2N2O2 — CID 158534274
6-bromo-1H-indene;6-bromo-1-propan-2-ylindole;1-propan-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 158534274) has the molecular formula C37H43BBr2N2O2 and a molecular weight of 718.38 g/mol. Its IUPAC name is 6-bromo-1H-indene;6-bromo-1-propan-2-ylindole;1-propan-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 6-bromo-1H-indene;6-bromo-1-propan-2-ylindole;1-propan-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 158534274 |
| Molecular Formula | C37H43BBr2N2O2 |
| Molecular Weight | 718.38 g/mol |
| Exact Mass | 716.18 |
| IUPAC Name | 6-bromo-1H-indene;6-bromo-1-propan-2-ylindole;1-propan-2-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | Brc1ccc2c(c1)CC=C2.CC(C)n1ccc2ccc(B3OC(C)(C)C(C)(C)O3)cc21.CC(C)n1ccc2ccc(Br)cc21 |
| InChI | InChI=1S/C17H24BNO2.C11H12BrN.C9H7Br/c1-12(2)19-10-9-13-7-8-14(11-15(13)19)18-20-16(3,4)17(5,6)21-18;1-8(2)13-6-5-9-3-4-10(12)7-11(9)13;10-9-5-4-7-2-1-3-8(7)6-9/h7-12H,1-6H3;3-8H,1-2H3;1-2,4-6H,3H2 |
| InChIKey | HNTFKDUJADYRJC-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 28.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.38 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|