C18H29Cl2N3Zn — CID 158535069
zinc;2-(4-octylphenyl)-1,2,5,6-tetrahydropyrimidin-4-amine;dichloride (PubChem CID 158535069) has the molecular formula C18H29Cl2N3Zn and a molecular weight of 423.75 g/mol. Its IUPAC name is zinc;2-(4-octylphenyl)-1,2,5,6-tetrahydropyrimidin-4-amine;dichloride.
| Compound Name | zinc;2-(4-octylphenyl)-1,2,5,6-tetrahydropyrimidin-4-amine;dichloride |
|---|---|
| PubChem CID | 158535069 |
| Molecular Formula | C18H29Cl2N3Zn |
| Molecular Weight | 423.75 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | zinc;2-(4-octylphenyl)-1,2,5,6-tetrahydropyrimidin-4-amine;dichloride |
| SMILES | CCCCCCCCc1ccc(C2N=C(N)CCN2)cc1.[Cl-].[Cl-].[Zn+2] |
| InChI | InChI=1S/C18H29N3.2ClH.Zn/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)18-20-14-13-17(19)21-18;;;/h9-12,18,20H,2-8,13-14H2,1H3,(H2,19,21);2*1H;/q;;;+2/p-2 |
| InChIKey | FYCACPIHZVZRKB-UHFFFAOYSA-L |
| XLogP | -2.06 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.75 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|