C14H27Cl3O4 — CID 158535901
carbonyl dichloride;3,3-dimethylbutan-1-ol;3,3-dimethylbutyl carbonochloridate (PubChem CID 158535901) has the molecular formula C14H27Cl3O4 and a molecular weight of 365.73 g/mol. Its IUPAC name is carbonyl dichloride;3,3-dimethylbutan-1-ol;3,3-dimethylbutyl carbonochloridate.
| Compound Name | carbonyl dichloride;3,3-dimethylbutan-1-ol;3,3-dimethylbutyl carbonochloridate |
|---|---|
| PubChem CID | 158535901 |
| Molecular Formula | C14H27Cl3O4 |
| Molecular Weight | 365.73 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | carbonyl dichloride;3,3-dimethylbutan-1-ol;3,3-dimethylbutyl carbonochloridate |
| SMILES | CC(C)(C)CCO.CC(C)(C)CCOC(=O)Cl.O=C(Cl)Cl |
| InChI | InChI=1S/C7H13ClO2.C6H14O.CCl2O/c1-7(2,3)4-5-10-6(8)9;1-6(2,3)4-5-7;2-1(3)4/h4-5H2,1-3H3;7H,4-5H2,1-3H3; |
| InChIKey | HNYCFJKYNVHKMU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.73 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|