About propane;trimethylphosphane
propane;trimethylphosphane (PubChem CID 158537949) has the molecular formula C6H17P
and a molecular weight of 120.18 g/mol. Its IUPAC name is propane;trimethylphosphane.
Molecular Properties
| Compound Name | propane;trimethylphosphane |
| PubChem CID | 158537949 |
| Molecular Formula | C6H17P |
| Molecular Weight | 120.18 g/mol |
| Exact Mass | 120.11 |
| IUPAC Name | propane;trimethylphosphane |
| SMILES | CCC.CP(C)C |
| InChI | InChI=1S/C3H9P.C3H8/c1-4(2)3;1-3-2/h1-3H3;3H2,1-2H3 |
| InChIKey | HOEBEDNPOFRKRL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze propane;trimethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;trimethylphosphane?
The IUPAC name of propane;trimethylphosphane (CID 158537949) is propane;trimethylphosphane.
What is the SMILES notation for propane;trimethylphosphane?
The canonical SMILES for propane;trimethylphosphane is CCC.CP(C)C.
What is the InChIKey of propane;trimethylphosphane?
The InChIKey is HOEBEDNPOFRKRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9P.C3H8/c1-4(2)3;1-3-2/h1-3H3;3H2,1-2H3.
What are the key properties of propane;trimethylphosphane?
propane;trimethylphosphane has a molecular weight of 120.18 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for propane;trimethylphosphane is sourced from PubChem (CID 158537949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).