C19H32N3O6P — CID 158541426
tert-butyl 4-(4-aminobenzoyl)piperazine-1-carboxylate;propylphosphonic acid (PubChem CID 158541426) has the molecular formula C19H32N3O6P and a molecular weight of 429.45 g/mol. Its IUPAC name is tert-butyl 4-(4-aminobenzoyl)piperazine-1-carboxylate;propylphosphonic acid.
| Compound Name | tert-butyl 4-(4-aminobenzoyl)piperazine-1-carboxylate;propylphosphonic acid |
|---|---|
| PubChem CID | 158541426 |
| Molecular Formula | C19H32N3O6P |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | tert-butyl 4-(4-aminobenzoyl)piperazine-1-carboxylate;propylphosphonic acid |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2ccc(N)cc2)CC1.CCCP(=O)(O)O |
| InChI | InChI=1S/C16H23N3O3.C3H9O3P/c1-16(2,3)22-15(21)19-10-8-18(9-11-19)14(20)12-4-6-13(17)7-5-12;1-2-3-7(4,5)6/h4-7H,8-11,17H2,1-3H3;2-3H2,1H3,(H2,4,5,6) |
| InChIKey | HOOIZQYJYQRQPT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|