C25H47N3O2 — CID 177362166
tert-butyl 4-heptan-3-ylpiperazine-1-carboxylate;ethane;4-methylaniline (PubChem CID 177362166) has the molecular formula C25H47N3O2 and a molecular weight of 421.67 g/mol. Its IUPAC name is tert-butyl 4-heptan-3-ylpiperazine-1-carboxylate;ethane;4-methylaniline.
| Compound Name | tert-butyl 4-heptan-3-ylpiperazine-1-carboxylate;ethane;4-methylaniline |
|---|---|
| PubChem CID | 177362166 |
| Molecular Formula | C25H47N3O2 |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.37 |
| IUPAC Name | tert-butyl 4-heptan-3-ylpiperazine-1-carboxylate;ethane;4-methylaniline |
| SMILES | CC.CCCCC(CC)N1CCN(C(=O)OC(C)(C)C)CC1.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C16H32N2O2.C7H9N.C2H6/c1-6-8-9-14(7-2)17-10-12-18(13-11-17)15(19)20-16(3,4)5;1-6-2-4-7(8)5-3-6;1-2/h14H,6-13H2,1-5H3;2-5H,8H2,1H3;1-2H3 |
| InChIKey | AXDUMGHMQMPBBK-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|