C12H16Cl3N5O — CID 158542036
1-carbamimidoyl-1-propan-2-yl-2-[(2,4,5-trichlorophenyl)methoxy]guanidine (PubChem CID 158542036) has the molecular formula C12H16Cl3N5O and a molecular weight of 352.65 g/mol. Its IUPAC name is 1-carbamimidoyl-1-propan-2-yl-2-[(2,4,5-trichlorophenyl)methoxy]guanidine.
| Compound Name | 1-carbamimidoyl-1-propan-2-yl-2-[(2,4,5-trichlorophenyl)methoxy]guanidine |
|---|---|
| PubChem CID | 158542036 |
| Molecular Formula | C12H16Cl3N5O |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 1-carbamimidoyl-1-propan-2-yl-2-[(2,4,5-trichlorophenyl)methoxy]guanidine |
| SMILES | [H]/N=C(\N)N(C(N)=NOCc1cc(Cl)c(Cl)cc1Cl)C(C)C |
| InChI | InChI=1S/C12H16Cl3N5O/c1-6(2)20(11(16)17)12(18)19-21-5-7-3-9(14)10(15)4-8(7)13/h3-4,6H,5H2,1-2H3,(H3,16,17)(H2,18,19) |
| InChIKey | FZWKZPZUDNNURT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|