C25H32N2O3 — CID 158544804
1-(4-phenylpiperidin-1-yl)ethanone;4-piperidin-4-ylbenzoic acid (PubChem CID 158544804) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 1-(4-phenylpiperidin-1-yl)ethanone;4-piperidin-4-ylbenzoic acid.
| Compound Name | 1-(4-phenylpiperidin-1-yl)ethanone;4-piperidin-4-ylbenzoic acid |
|---|---|
| PubChem CID | 158544804 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 1-(4-phenylpiperidin-1-yl)ethanone;4-piperidin-4-ylbenzoic acid |
| SMILES | CC(=O)N1CCC(c2ccccc2)CC1.O=C(O)c1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C13H17NO.C12H15NO2/c1-11(15)14-9-7-13(8-10-14)12-5-3-2-4-6-12;14-12(15)11-3-1-9(2-4-11)10-5-7-13-8-6-10/h2-6,13H,7-10H2,1H3;1-4,10,13H,5-8H2,(H,14,15) |
| InChIKey | HOZCCECWWGUDRG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |