C32H53N5O — CID 158546455
2-cyclohexyl-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(4-pyrrolidin-1-ylbutyl)quinazolin-4-amine;methane (PubChem CID 158546455) has the molecular formula C32H53N5O and a molecular weight of 523.81 g/mol. Its IUPAC name is 2-cyclohexyl-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(4-pyrrolidin-1-ylbutyl)quinazolin-4-amine;methane.
| Compound Name | 2-cyclohexyl-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(4-pyrrolidin-1-ylbutyl)quinazolin-4-amine;methane |
|---|---|
| PubChem CID | 158546455 |
| Molecular Formula | C32H53N5O |
| Molecular Weight | 523.81 g/mol |
| Exact Mass | 523.43 |
| IUPAC Name | 2-cyclohexyl-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(4-pyrrolidin-1-ylbutyl)quinazolin-4-amine;methane |
| SMILES | C.COc1cc2c(NC3CCN(C(C)C)CC3)nc(C3CCCCC3)nc2cc1CCCCN1CCCC1 |
| InChI | InChI=1S/C31H49N5O.CH4/c1-23(2)36-19-14-26(15-20-36)32-31-27-22-29(37-3)25(13-7-8-16-35-17-9-10-18-35)21-28(27)33-30(34-31)24-11-5-4-6-12-24;/h21-24,26H,4-20H2,1-3H3,(H,32,33,34);1H4 |
| InChIKey | HPECLBOBNMBWGM-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.81 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|