About 1-ethenyl-4-nitropyrazole;4-nitro-1H-pyrazole
1-ethenyl-4-nitropyrazole;4-nitro-1H-pyrazole (PubChem CID 158547215) has the molecular formula C8H8N6O4
and a molecular weight of 252.19 g/mol. Its IUPAC name is 1-ethenyl-4-nitropyrazole;4-nitro-1H-pyrazole.
Molecular Properties
| Compound Name | 1-ethenyl-4-nitropyrazole;4-nitro-1H-pyrazole |
| PubChem CID | 158547215 |
| Molecular Formula | C8H8N6O4 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 1-ethenyl-4-nitropyrazole;4-nitro-1H-pyrazole |
| SMILES | C=Cn1cc([N+](=O)[O-])cn1.O=[N+]([O-])c1cn[nH]c1 |
| InChI | InChI=1S/C5H5N3O2.C3H3N3O2/c1-2-7-4-5(3-6-7)8(9)10;7-6(8)3-1-4-5-2-3/h2-4H,1H2;1-2H,(H,4,5) |
| InChIKey | HPGQYVFZKKHHNZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-4-nitropyrazole;4-nitro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4-nitropyrazole;4-nitro-1H-pyrazole?
The IUPAC name of 1-ethenyl-4-nitropyrazole;4-nitro-1H-pyrazole (CID 158547215) is 1-ethenyl-4-nitropyrazole;4-nitro-1H-pyrazole.
What is the SMILES notation for 1-ethenyl-4-nitropyrazole;4-nitro-1H-pyrazole?
The canonical SMILES for 1-ethenyl-4-nitropyrazole;4-nitro-1H-pyrazole is C=Cn1cc([N+](=O)[O-])cn1.O=[N+]([O-])c1cn[nH]c1.
What is the InChIKey of 1-ethenyl-4-nitropyrazole;4-nitro-1H-pyrazole?
The InChIKey is HPGQYVFZKKHHNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O2.C3H3N3O2/c1-2-7-4-5(3-6-7)8(9)10;7-6(8)3-1-4-5-2-3/h2-4H,1H2;1-2H,(H,4,5).
What are the key properties of 1-ethenyl-4-nitropyrazole;4-nitro-1H-pyrazole?
1-ethenyl-4-nitropyrazole;4-nitro-1H-pyrazole has a molecular weight of 252.19 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4-nitropyrazole;4-nitro-1H-pyrazole is sourced from PubChem (CID 158547215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).