C13H19N9O6 — CID 159607238
2-(4-aminopyrazol-1-yl)ethanol;4-nitro-1H-pyrazole;2-(4-nitropyrazol-1-yl)ethanol (PubChem CID 159607238) has the molecular formula C13H19N9O6 and a molecular weight of 397.35 g/mol. Its IUPAC name is 2-(4-aminopyrazol-1-yl)ethanol;4-nitro-1H-pyrazole;2-(4-nitropyrazol-1-yl)ethanol.
| Compound Name | 2-(4-aminopyrazol-1-yl)ethanol;4-nitro-1H-pyrazole;2-(4-nitropyrazol-1-yl)ethanol |
|---|---|
| PubChem CID | 159607238 |
| Molecular Formula | C13H19N9O6 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-(4-aminopyrazol-1-yl)ethanol;4-nitro-1H-pyrazole;2-(4-nitropyrazol-1-yl)ethanol |
| SMILES | Nc1cnn(CCO)c1.O=[N+]([O-])c1cn[nH]c1.O=[N+]([O-])c1cnn(CCO)c1 |
| InChI | InChI=1S/C5H7N3O3.C5H9N3O.C3H3N3O2/c9-2-1-7-4-5(3-6-7)8(10)11;6-5-3-7-8(4-5)1-2-9;7-6(8)3-1-4-5-2-3/h3-4,9H,1-2H2;3-4,9H,1-2,6H2;1-2H,(H,4,5) |
| InChIKey | MMFTYPUCWMEVMS-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 217.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|