C9H11N5O5 — CID 154805233
5-(hydroxymethyl)-3-[2-(4-nitropyrazol-1-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 154805233) has the molecular formula C9H11N5O5 and a molecular weight of 269.22 g/mol. Its IUPAC name is 5-(hydroxymethyl)-3-[2-(4-nitropyrazol-1-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5-(hydroxymethyl)-3-[2-(4-nitropyrazol-1-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154805233 |
| Molecular Formula | C9H11N5O5 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 5-(hydroxymethyl)-3-[2-(4-nitropyrazol-1-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(CO)C(=O)N1CCn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C9H11N5O5/c15-5-7-8(16)13(9(17)11-7)2-1-12-4-6(3-10-12)14(18)19/h3-4,7,15H,1-2,5H2,(H,11,17) |
| InChIKey | OOXGBXZWOSBEER-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|