C20H34N8O4 — CID 162086234
1-[2-(4-aminopyrazol-1-yl)ethyl]piperidin-3-ol;1-[2-(4-nitropyrazol-1-yl)ethyl]piperidin-3-ol (PubChem CID 162086234) has the molecular formula C20H34N8O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 1-[2-(4-aminopyrazol-1-yl)ethyl]piperidin-3-ol;1-[2-(4-nitropyrazol-1-yl)ethyl]piperidin-3-ol.
| Compound Name | 1-[2-(4-aminopyrazol-1-yl)ethyl]piperidin-3-ol;1-[2-(4-nitropyrazol-1-yl)ethyl]piperidin-3-ol |
|---|---|
| PubChem CID | 162086234 |
| Molecular Formula | C20H34N8O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 1-[2-(4-aminopyrazol-1-yl)ethyl]piperidin-3-ol;1-[2-(4-nitropyrazol-1-yl)ethyl]piperidin-3-ol |
| SMILES | Nc1cnn(CCN2CCCC(O)C2)c1.O=[N+]([O-])c1cnn(CCN2CCCC(O)C2)c1 |
| InChI | InChI=1S/C10H16N4O3.C10H18N4O/c15-10-2-1-3-12(8-10)4-5-13-7-9(6-11-13)14(16)17;11-9-6-12-14(7-9)5-4-13-3-1-2-10(15)8-13/h6-7,10,15H,1-5,8H2;6-7,10,15H,1-5,8,11H2 |
| InChIKey | ZCZMULNGTKNHPP-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 151.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|