C11H15BrN4O2S — CID 95321024
(5S)-3-[2-(4-bromopyrazol-1-yl)ethyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione (PubChem CID 95321024) has the molecular formula C11H15BrN4O2S and a molecular weight of 347.24 g/mol. Its IUPAC name is (5S)-3-[2-(4-bromopyrazol-1-yl)ethyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-(4-bromopyrazol-1-yl)ethyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95321024 |
| Molecular Formula | C11H15BrN4O2S |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | (5S)-3-[2-(4-bromopyrazol-1-yl)ethyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione |
| SMILES | CSCC[C@@H]1NC(=O)N(CCn2cc(Br)cn2)C1=O |
| InChI | InChI=1S/C11H15BrN4O2S/c1-19-5-2-9-10(17)16(11(18)14-9)4-3-15-7-8(12)6-13-15/h6-7,9H,2-5H2,1H3,(H,14,18)/t9-/m0/s1 |
| InChIKey | SZXFZECJAYTDHE-VIFPVBQESA-N |
| XLogP | 1.32 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|