C8H15N3O2S — CID 82147808
3-(2-aminoethyl)-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione (PubChem CID 82147808) has the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. Its IUPAC name is 3-(2-aminoethyl)-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione.
| Compound Name | 3-(2-aminoethyl)-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 82147808 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3-(2-aminoethyl)-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione |
| SMILES | CSCCC1NC(=O)N(CCN)C1=O |
| InChI | InChI=1S/C8H15N3O2S/c1-14-5-2-6-7(12)11(4-3-9)8(13)10-6/h6H,2-5,9H2,1H3,(H,10,13) |
| InChIKey | XCGJCWPVYJAPED-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|