C14H15ClN4O2S — CID 29358215
(5R)-3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione (PubChem CID 29358215) has the molecular formula C14H15ClN4O2S and a molecular weight of 338.82 g/mol. Its IUPAC name is (5R)-3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 29358215 |
| Molecular Formula | C14H15ClN4O2S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (5R)-3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione |
| SMILES | CSCC[C@H]1NC(=O)N(Cc2cn3cc(Cl)ccc3n2)C1=O |
| InChI | InChI=1S/C14H15ClN4O2S/c1-22-5-4-11-13(20)19(14(21)17-11)8-10-7-18-6-9(15)2-3-12(18)16-10/h2-3,6-7,11H,4-5,8H2,1H3,(H,17,21)/t11-/m1/s1 |
| InChIKey | GONAGAXVDGJMHJ-LLVKDONJSA-N |
| XLogP | 2.16 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|