C12H25F5N2O3 — CID 158547627
2-amino-4-methyl-N-[3-(3-oxopropoxy)propyl]pentanamide;molecular fluorine;hydrofluoride (PubChem CID 158547627) has the molecular formula C12H25F5N2O3 and a molecular weight of 340.33 g/mol. Its IUPAC name is 2-amino-4-methyl-N-[3-(3-oxopropoxy)propyl]pentanamide;molecular fluorine;hydrofluoride.
| Compound Name | 2-amino-4-methyl-N-[3-(3-oxopropoxy)propyl]pentanamide;molecular fluorine;hydrofluoride |
|---|---|
| PubChem CID | 158547627 |
| Molecular Formula | C12H25F5N2O3 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-amino-4-methyl-N-[3-(3-oxopropoxy)propyl]pentanamide;molecular fluorine;hydrofluoride |
| SMILES | CC(C)CC(N)C(=O)NCCCOCCC=O.F.FF.FF |
| InChI | InChI=1S/C12H24N2O3.2F2.FH/c1-10(2)9-11(13)12(16)14-5-3-7-17-8-4-6-15;2*1-2;/h6,10-11H,3-5,7-9,13H2,1-2H3,(H,14,16);;;1H |
| InChIKey | HPHWKZRUZPFMEN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|