C41H47ClN6O — CID 158549161
1-benzyl-3-tert-butyl-N-(4-chlorophenyl)pyrazole-5-carboxamide;4-(1-benzylindazol-3-yl)-N-ethylbutan-1-amine (PubChem CID 158549161) has the molecular formula C41H47ClN6O and a molecular weight of 675.32 g/mol. Its IUPAC name is 1-benzyl-3-tert-butyl-N-(4-chlorophenyl)pyrazole-5-carboxamide;4-(1-benzylindazol-3-yl)-N-ethylbutan-1-amine.
| Compound Name | 1-benzyl-3-tert-butyl-N-(4-chlorophenyl)pyrazole-5-carboxamide;4-(1-benzylindazol-3-yl)-N-ethylbutan-1-amine |
|---|---|
| PubChem CID | 158549161 |
| Molecular Formula | C41H47ClN6O |
| Molecular Weight | 675.32 g/mol |
| Exact Mass | 674.35 |
| IUPAC Name | 1-benzyl-3-tert-butyl-N-(4-chlorophenyl)pyrazole-5-carboxamide;4-(1-benzylindazol-3-yl)-N-ethylbutan-1-amine |
| SMILES | CC(C)(C)c1cc(C(=O)Nc2ccc(Cl)cc2)n(Cc2ccccc2)n1.CCNCCCCc1nn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C21H22ClN3O.C20H25N3/c1-21(2,3)19-13-18(20(26)23-17-11-9-16(22)10-12-17)25(24-19)14-15-7-5-4-6-8-15;1-2-21-15-9-8-13-19-18-12-6-7-14-20(18)23(22-19)16-17-10-4-3-5-11-17/h4-13H,14H2,1-3H3,(H,23,26);3-7,10-12,14,21H,2,8-9,13,15-16H2,1H3 |
| InChIKey | HPMPASFHQNPMFP-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 76.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.32 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|