C21H23ClN4O — CID 2812493
1-benzyl-3-tert-butyl-N'-(3-chlorophenyl)pyrazole-5-carbohydrazide (PubChem CID 2812493) has the molecular formula C21H23ClN4O and a molecular weight of 382.90 g/mol. Its IUPAC name is 1-benzyl-3-tert-butyl-N'-(3-chlorophenyl)pyrazole-5-carbohydrazide.
| Compound Name | 1-benzyl-3-tert-butyl-N'-(3-chlorophenyl)pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2812493 |
| Molecular Formula | C21H23ClN4O |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-benzyl-3-tert-butyl-N'-(3-chlorophenyl)pyrazole-5-carbohydrazide |
| SMILES | CC(C)(C)c1cc(C(=O)NNc2cccc(Cl)c2)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C21H23ClN4O/c1-21(2,3)19-13-18(26(25-19)14-15-8-5-4-6-9-15)20(27)24-23-17-11-7-10-16(22)12-17/h4-13,23H,14H2,1-3H3,(H,24,27) |
| InChIKey | BWHKFQLAZFINNK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|