C18H23ClNO3+ — CID 158550374
[(2S)-1,6-bis(4-hydroxyphenyl)-3-oxohexan-2-yl]azanium;hydrochloride (PubChem CID 158550374) has the molecular formula C18H23ClNO3+ and a molecular weight of 336.84 g/mol. Its IUPAC name is [(2S)-1,6-bis(4-hydroxyphenyl)-3-oxohexan-2-yl]azanium;hydrochloride.
| Compound Name | [(2S)-1,6-bis(4-hydroxyphenyl)-3-oxohexan-2-yl]azanium;hydrochloride |
|---|---|
| PubChem CID | 158550374 |
| Molecular Formula | C18H23ClNO3+ |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | [(2S)-1,6-bis(4-hydroxyphenyl)-3-oxohexan-2-yl]azanium;hydrochloride |
| SMILES | Cl.[NH3+][C@@H](Cc1ccc(O)cc1)C(=O)CCCc1ccc(O)cc1 |
| InChI | InChI=1S/C18H21NO3.ClH/c19-17(12-14-6-10-16(21)11-7-14)18(22)3-1-2-13-4-8-15(20)9-5-13;/h4-11,17,20-21H,1-3,12,19H2;1H/p+1/t17-;/m0./s1 |
| InChIKey | QBVIWGKVGGOTJA-LMOVPXPDSA-O |
| XLogP | 2.26 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |