C20H21Cl2N3 — CID 158550826
5,6-dichloro-2-[4-(4-ethylpiperazin-1-yl)phenyl]-3H-indole (PubChem CID 158550826) has the molecular formula C20H21Cl2N3 and a molecular weight of 374.32 g/mol. Its IUPAC name is 5,6-dichloro-2-[4-(4-ethylpiperazin-1-yl)phenyl]-3H-indole.
| Compound Name | 5,6-dichloro-2-[4-(4-ethylpiperazin-1-yl)phenyl]-3H-indole |
|---|---|
| PubChem CID | 158550826 |
| Molecular Formula | C20H21Cl2N3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 5,6-dichloro-2-[4-(4-ethylpiperazin-1-yl)phenyl]-3H-indole |
| SMILES | CCN1CCN(c2ccc(C3=Nc4cc(Cl)c(Cl)cc4C3)cc2)CC1 |
| InChI | InChI=1S/C20H21Cl2N3/c1-2-24-7-9-25(10-8-24)16-5-3-14(4-6-16)19-12-15-11-17(21)18(22)13-20(15)23-19/h3-6,11,13H,2,7-10,12H2,1H3 |
| InChIKey | PUBAQEYLQCARAD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |