C27H39N3O2 — CID 158562900
[(5aR,9aR)-spiro[5a,6,7,8,9,9a-hexahydro-5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-yl]-(4-tert-butyl-3-methoxyphenyl)methanone;molecular hydrogen (PubChem CID 158562900) has the molecular formula C27H39N3O2 and a molecular weight of 437.63 g/mol. Its IUPAC name is [(5aR,9aR)-spiro[5a,6,7,8,9,9a-hexahydro-5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-yl]-(4-tert-butyl-3-methoxyphenyl)methanone;molecular hydrogen.
| Compound Name | [(5aR,9aR)-spiro[5a,6,7,8,9,9a-hexahydro-5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-yl]-(4-tert-butyl-3-methoxyphenyl)methanone;molecular hydrogen |
|---|---|
| PubChem CID | 158562900 |
| Molecular Formula | C27H39N3O2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | [(5aR,9aR)-spiro[5a,6,7,8,9,9a-hexahydro-5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-yl]-(4-tert-butyl-3-methoxyphenyl)methanone;molecular hydrogen |
| SMILES | COc1cc(C(=O)N2CCC3(CC2)N[C@@H]2CCCC[C@H]2n2cccc23)ccc1C(C)(C)C.[H][H] |
| InChI | InChI=1S/C27H37N3O2.H2/c1-26(2,3)20-12-11-19(18-23(20)32-4)25(31)29-16-13-27(14-17-29)24-10-7-15-30(24)22-9-6-5-8-21(22)28-27;/h7,10-12,15,18,21-22,28H,5-6,8-9,13-14,16-17H2,1-4H3;1H/t21-,22-;/m1./s1 |
| InChIKey | HRCKXLCRIWGLOU-HLUKFBSCSA-N |
| XLogP | 5.26 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |