C20H22N2O6 — CID 158564380
(6-methyl-1,3-dioxo-2-phenyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) 4-(methylamino)-4-oxobutanoate (PubChem CID 158564380) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is (6-methyl-1,3-dioxo-2-phenyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) 4-(methylamino)-4-oxobutanoate.
| Compound Name | (6-methyl-1,3-dioxo-2-phenyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) 4-(methylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 158564380 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (6-methyl-1,3-dioxo-2-phenyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) 4-(methylamino)-4-oxobutanoate |
| SMILES | CNC(=O)CCC(=O)OC1C(C)C2OC1C1C(=O)N(c3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C20H22N2O6/c1-10-16-14-15(20(26)22(19(14)25)11-6-4-3-5-7-11)18(28-16)17(10)27-13(24)9-8-12(23)21-2/h3-7,10,14-18H,8-9H2,1-2H3,(H,21,23) |
| InChIKey | YLHNSKOFLNTPEH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|