C42H58N4O4 — CID 158568801
N-[2-[2-hydroxy-3-(6-octanoylimino-4-piperidin-1-ylcyclohexa-2,4-dien-1-ylidene)-4-oxocyclobuten-1-yl]-5-piperidin-1-ylphenyl]octanamide (PubChem CID 158568801) has the molecular formula C42H58N4O4 and a molecular weight of 682.95 g/mol. Its IUPAC name is N-[2-[2-hydroxy-3-(6-octanoylimino-4-piperidin-1-ylcyclohexa-2,4-dien-1-ylidene)-4-oxocyclobuten-1-yl]-5-piperidin-1-ylphenyl]octanamide.
| Compound Name | N-[2-[2-hydroxy-3-(6-octanoylimino-4-piperidin-1-ylcyclohexa-2,4-dien-1-ylidene)-4-oxocyclobuten-1-yl]-5-piperidin-1-ylphenyl]octanamide |
|---|---|
| PubChem CID | 158568801 |
| Molecular Formula | C42H58N4O4 |
| Molecular Weight | 682.95 g/mol |
| Exact Mass | 682.45 |
| IUPAC Name | N-[2-[2-hydroxy-3-(6-octanoylimino-4-piperidin-1-ylcyclohexa-2,4-dien-1-ylidene)-4-oxocyclobuten-1-yl]-5-piperidin-1-ylphenyl]octanamide |
| SMILES | CCCCCCCC(=O)/N=C1\C=C(N2CCCCC2)C=CC1=C1C(=O)C(c2ccc(N3CCCCC3)cc2NC(=O)CCCCCCC)=C1O |
| InChI | InChI=1S/C42H58N4O4/c1-3-5-7-9-13-19-37(47)43-35-29-31(45-25-15-11-16-26-45)21-23-33(35)39-41(49)40(42(39)50)34-24-22-32(46-27-17-12-18-28-46)30-36(34)44-38(48)20-14-10-8-6-4-2/h21-24,29-30,49H,3-20,25-28H2,1-2H3,(H,43,47)/b40-34?,44-36+ |
| InChIKey | OVYJMVIATVLAIZ-QEYIRJEKSA-N |
| XLogP | 9.39 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.95 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|