C29H36N4O4 — CID 137126267
N-[(6E)-6-[3-(2-acetamido-4-pyrrolidin-1-ylphenyl)-2,4-dihydroxycyclobut-2-en-1-ylidene]-3-pentyliminocyclohexa-1,4-dien-1-yl]acetamide (PubChem CID 137126267) has the molecular formula C29H36N4O4 and a molecular weight of 504.63 g/mol. Its IUPAC name is N-[(6E)-6-[3-(2-acetamido-4-pyrrolidin-1-ylphenyl)-2,4-dihydroxycyclobut-2-en-1-ylidene]-3-pentyliminocyclohexa-1,4-dien-1-yl]acetamide.
| Compound Name | N-[(6E)-6-[3-(2-acetamido-4-pyrrolidin-1-ylphenyl)-2,4-dihydroxycyclobut-2-en-1-ylidene]-3-pentyliminocyclohexa-1,4-dien-1-yl]acetamide |
|---|---|
| PubChem CID | 137126267 |
| Molecular Formula | C29H36N4O4 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | N-[(6E)-6-[3-(2-acetamido-4-pyrrolidin-1-ylphenyl)-2,4-dihydroxycyclobut-2-en-1-ylidene]-3-pentyliminocyclohexa-1,4-dien-1-yl]acetamide |
| SMILES | CCCCC/N=C1\C=C/C(=C2\C(O)=C(c3ccc(N4CCCC4)cc3NC(C)=O)C2O)C(NC(C)=O)=C1 |
| InChI | InChI=1S/C29H36N4O4/c1-4-5-6-13-30-20-9-11-22(24(16-20)31-18(2)34)26-28(36)27(29(26)37)23-12-10-21(33-14-7-8-15-33)17-25(23)32-19(3)35/h9-12,16-17,28,36-37H,4-8,13-15H2,1-3H3,(H,31,34)(H,32,35)/b26-22+,30-20+ |
| InChIKey | WWFMQBBPTWIUBL-XNEDTXOYSA-N |
| XLogP | 4.41 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|