carbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole

C7H8F3NO3 — CID 158570874

IUPACcarbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole
SMILESCCC1=NOC(C(F)(F)F)C1.O=C=O
InChIInChI=1S/C6H8F3NO.CO2/c1-2-4-3-5(11-10-4)6(7,8)9;2-1-3/h5H,2-3H2,1H3;
InChIKeyHSBGIYZSLIVBDY-UHFFFAOYSA-N
MW211.14 g/mol
LogP1.52
Rot. Bonds1

About carbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole

carbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole (PubChem CID 158570874) has the molecular formula C7H8F3NO3 and a molecular weight of 211.14 g/mol. Its IUPAC name is carbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole.

Molecular Properties

Compound Namecarbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole
PubChem CID158570874
Molecular FormulaC7H8F3NO3
Molecular Weight211.14 g/mol
Exact Mass211.05
IUPAC Namecarbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole
SMILESCCC1=NOC(C(F)(F)F)C1.O=C=O
InChIInChI=1S/C6H8F3NO.CO2/c1-2-4-3-5(11-10-4)6(7,8)9;2-1-3/h5H,2-3H2,1H3;
InChIKeyHSBGIYZSLIVBDY-UHFFFAOYSA-N
XLogP1.52
TPSA55.73 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.14
LogP ≤ 51.52
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze carbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole?
The IUPAC name of carbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole (CID 158570874) is carbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for carbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole?
The canonical SMILES for carbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole is CCC1=NOC(C(F)(F)F)C1.O=C=O.
What is the InChIKey of carbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole?
The InChIKey is HSBGIYZSLIVBDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F3NO.CO2/c1-2-4-3-5(11-10-4)6(7,8)9;2-1-3/h5H,2-3H2,1H3;.
What are the key properties of carbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole?
carbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole has a molecular weight of 211.14 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;3-ethyl-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 158570874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).