C31H26Cl2N6O5 — CID 158573542
2-(3-chloro-2-nitrophenyl)-4-methyl-1H-benzimidazole;1-[2-(3-chloro-2-nitrophenyl)-4-methylbenzimidazol-1-yl]propan-2-ol (PubChem CID 158573542) has the molecular formula C31H26Cl2N6O5 and a molecular weight of 633.49 g/mol. Its IUPAC name is 2-(3-chloro-2-nitrophenyl)-4-methyl-1H-benzimidazole;1-[2-(3-chloro-2-nitrophenyl)-4-methylbenzimidazol-1-yl]propan-2-ol.
| Compound Name | 2-(3-chloro-2-nitrophenyl)-4-methyl-1H-benzimidazole;1-[2-(3-chloro-2-nitrophenyl)-4-methylbenzimidazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 158573542 |
| Molecular Formula | C31H26Cl2N6O5 |
| Molecular Weight | 633.49 g/mol |
| Exact Mass | 632.13 |
| IUPAC Name | 2-(3-chloro-2-nitrophenyl)-4-methyl-1H-benzimidazole;1-[2-(3-chloro-2-nitrophenyl)-4-methylbenzimidazol-1-yl]propan-2-ol |
| SMILES | Cc1cccc2[nH]c(-c3cccc(Cl)c3[N+](=O)[O-])nc12.Cc1cccc2c1nc(-c1cccc(Cl)c1[N+](=O)[O-])n2CC(C)O |
| InChI | InChI=1S/C17H16ClN3O3.C14H10ClN3O2/c1-10-5-3-8-14-15(10)19-17(20(14)9-11(2)22)12-6-4-7-13(18)16(12)21(23)24;1-8-4-2-7-11-12(8)17-14(16-11)9-5-3-6-10(15)13(9)18(19)20/h3-8,11,22H,9H2,1-2H3;2-7H,1H3,(H,16,17) |
| InChIKey | HSJLCTMUJIOHAD-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 153.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.49 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|