C19H19N3O — CID 15857587
4-(2,6-dipyridin-2-yl-4-pyridinyl)butan-1-ol (PubChem CID 15857587) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-(2,6-dipyridin-2-yl-4-pyridinyl)butan-1-ol.
| Compound Name | 4-(2,6-dipyridin-2-yl-4-pyridinyl)butan-1-ol |
|---|---|
| PubChem CID | 15857587 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 4-(2,6-dipyridin-2-yl-4-pyridinyl)butan-1-ol |
| SMILES | OCCCCc1cc(-c2ccccn2)nc(-c2ccccn2)c1 |
| InChI | InChI=1S/C19H19N3O/c23-12-6-3-7-15-13-18(16-8-1-4-10-20-16)22-19(14-15)17-9-2-5-11-21-17/h1-2,4-5,8-11,13-14,23H,3,6-7,12H2 |
| InChIKey | MKBWYLDVOFVUFX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|