C40H42CoN6S2+2 — CID 139250043
cobalt(2+);bis(5-(2,6-dipyridin-2-yl-4-pyridinyl)pentane-1-thiol) (PubChem CID 139250043) has the molecular formula C40H42CoN6S2+2 and a molecular weight of 729.89 g/mol. Its IUPAC name is cobalt(2+);bis(5-(2,6-dipyridin-2-yl-4-pyridinyl)pentane-1-thiol).
| Compound Name | cobalt(2+);bis(5-(2,6-dipyridin-2-yl-4-pyridinyl)pentane-1-thiol) |
|---|---|
| PubChem CID | 139250043 |
| Molecular Formula | C40H42CoN6S2+2 |
| Molecular Weight | 729.89 g/mol |
| Exact Mass | 729.22 |
| IUPAC Name | cobalt(2+);bis(5-(2,6-dipyridin-2-yl-4-pyridinyl)pentane-1-thiol) |
| SMILES | SCCCCCc1cc(-c2ccccn2)nc(-c2ccccn2)c1.SCCCCCc1cc(-c2ccccn2)nc(-c2ccccn2)c1.[Co+2] |
| InChI | InChI=1S/2C20H21N3S.Co/c2*24-13-7-1-2-8-16-14-19(17-9-3-5-11-21-17)23-20(15-16)18-10-4-6-12-22-18;/h2*3-6,9-12,14-15,24H,1-2,7-8,13H2;/q;;+2 |
| InChIKey | FFOHBZCGGSHHAC-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.89 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|