C35H51N4O7+ — CID 158579823
[2-acetyloxy-4-[2-[4-[[2-carbamoyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)phenyl]methyl]cyclohexyl]oxyethoxy]-4-oxobutyl]-trimethylazanium (PubChem CID 158579823) has the molecular formula C35H51N4O7+ and a molecular weight of 639.81 g/mol. Its IUPAC name is [2-acetyloxy-4-[2-[4-[[2-carbamoyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)phenyl]methyl]cyclohexyl]oxyethoxy]-4-oxobutyl]-trimethylazanium.
| Compound Name | [2-acetyloxy-4-[2-[4-[[2-carbamoyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)phenyl]methyl]cyclohexyl]oxyethoxy]-4-oxobutyl]-trimethylazanium |
|---|---|
| PubChem CID | 158579823 |
| Molecular Formula | C35H51N4O7+ |
| Molecular Weight | 639.81 g/mol |
| Exact Mass | 639.38 |
| IUPAC Name | [2-acetyloxy-4-[2-[4-[[2-carbamoyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)phenyl]methyl]cyclohexyl]oxyethoxy]-4-oxobutyl]-trimethylazanium |
| SMILES | CC(=O)OC(CC(=O)OCCOC1CCC(Cc2cc(-n3nc(C)c4c3CC(C)(C)CC4=O)ccc2C(N)=O)CC1)C[N+](C)(C)C |
| InChI | InChI=1S/C35H50N4O7/c1-22-33-30(19-35(3,4)20-31(33)41)38(37-22)26-10-13-29(34(36)43)25(17-26)16-24-8-11-27(12-9-24)44-14-15-45-32(42)18-28(46-23(2)40)21-39(5,6)7/h10,13,17,24,27-28H,8-9,11-12,14-16,18-21H2,1-7H3,(H-,36,43)/p+1 |
| InChIKey | HTCMVBWULIOOJX-UHFFFAOYSA-O |
| XLogP | 4.12 |
| TPSA | 139.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.81 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|