About bis((Z)-2-benzylbut-2-enedioate);tin(4+)
bis((Z)-2-benzylbut-2-enedioate);tin(4+) (PubChem CID 158581262) has the molecular formula C22H16O8Sn
and a molecular weight of 527.07 g/mol. Its IUPAC name is bis((Z)-2-benzylbut-2-enedioate);tin(4+).
Molecular Properties
| Compound Name | bis((Z)-2-benzylbut-2-enedioate);tin(4+) |
| PubChem CID | 158581262 |
| Molecular Formula | C22H16O8Sn |
| Molecular Weight | 527.07 g/mol |
| Exact Mass | 527.99 |
| IUPAC Name | bis((Z)-2-benzylbut-2-enedioate);tin(4+) |
| SMILES | O=C([O-])/C=C(/Cc1ccccc1)C(=O)[O-].O=C([O-])/C=C(/Cc1ccccc1)C(=O)[O-].[Sn+4] |
| InChI | InChI=1S/2C11H10O4.Sn/c2*12-10(13)7-9(11(14)15)6-8-4-2-1-3-5-8;/h2*1-5,7H,6H2,(H,12,13)(H,14,15);/q;;+4/p-4/b2*9-7-; |
| InChIKey | HTGWAZARQZCUQB-LHSHWCRNSA-J |
| XLogP | -3.07 |
| TPSA | 160.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 527.07 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((Z)-2-benzylbut-2-enedioate);tin(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((Z)-2-benzylbut-2-enedioate);tin(4+)?
The IUPAC name of bis((Z)-2-benzylbut-2-enedioate);tin(4+) (CID 158581262) is bis((Z)-2-benzylbut-2-enedioate);tin(4+).
What is the SMILES notation for bis((Z)-2-benzylbut-2-enedioate);tin(4+)?
The canonical SMILES for bis((Z)-2-benzylbut-2-enedioate);tin(4+) is O=C([O-])/C=C(/Cc1ccccc1)C(=O)[O-].O=C([O-])/C=C(/Cc1ccccc1)C(=O)[O-].[Sn+4].
What is the InChIKey of bis((Z)-2-benzylbut-2-enedioate);tin(4+)?
The InChIKey is HTGWAZARQZCUQB-LHSHWCRNSA-J. The full InChI is InChI=1S/2C11H10O4.Sn/c2*12-10(13)7-9(11(14)15)6-8-4-2-1-3-5-8;/h2*1-5,7H,6H2,(H,12,13)(H,14,15);/q;;+4/p-4/b2*9-7-;.
What are the key properties of bis((Z)-2-benzylbut-2-enedioate);tin(4+)?
bis((Z)-2-benzylbut-2-enedioate);tin(4+) has a molecular weight of 527.07 g/mol, XLogP of -3.07, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis((Z)-2-benzylbut-2-enedioate);tin(4+) is sourced from PubChem (CID 158581262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).