C4H3F3KN3S — CID 158595514
potassium 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-thiolate (PubChem CID 158595514) has the molecular formula C4H3F3KN3S and a molecular weight of 221.25 g/mol. Its IUPAC name is potassium 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-thiolate.
| Compound Name | potassium 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-thiolate |
|---|---|
| PubChem CID | 158595514 |
| Molecular Formula | C4H3F3KN3S |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 220.96 |
| IUPAC Name | potassium 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-thiolate |
| SMILES | Cn1c([S-])nnc1C(F)(F)F.[K+] |
| InChI | InChI=1S/C4H4F3N3S.K/c1-10-2(4(5,6)7)8-9-3(10)11;/h1H3,(H,9,11);/q;+1/p-1 |
| InChIKey | SCIIFAMZUAZYFG-UHFFFAOYSA-M |
| XLogP | -2.26 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|