C38H48N6O4 — CID 158596776
(2S)-2-amino-2-methyl-3-(4-methylphenyl)propanamide;N-benzylformamide;(2S)-2-[[(S)-formamido(phenyl)methyl]amino]-2-methyl-3-(4-methylphenyl)propanamide (PubChem CID 158596776) has the molecular formula C38H48N6O4 and a molecular weight of 652.84 g/mol. Its IUPAC name is (2S)-2-amino-2-methyl-3-(4-methylphenyl)propanamide;N-benzylformamide;(2S)-2-[[(S)-formamido(phenyl)methyl]amino]-2-methyl-3-(4-methylphenyl)propanamide.
| Compound Name | (2S)-2-amino-2-methyl-3-(4-methylphenyl)propanamide;N-benzylformamide;(2S)-2-[[(S)-formamido(phenyl)methyl]amino]-2-methyl-3-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 158596776 |
| Molecular Formula | C38H48N6O4 |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.37 |
| IUPAC Name | (2S)-2-amino-2-methyl-3-(4-methylphenyl)propanamide;N-benzylformamide;(2S)-2-[[(S)-formamido(phenyl)methyl]amino]-2-methyl-3-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(C[C@](C)(N)C(N)=O)cc1.Cc1ccc(C[C@](C)(N[C@@H](NC=O)c2ccccc2)C(N)=O)cc1.O=CNCc1ccccc1 |
| InChI | InChI=1S/C19H23N3O2.C11H16N2O.C8H9NO/c1-14-8-10-15(11-9-14)12-19(2,18(20)24)22-17(21-13-23)16-6-4-3-5-7-16;1-8-3-5-9(6-4-8)7-11(2,13)10(12)14;10-7-9-6-8-4-2-1-3-5-8/h3-11,13,17,22H,12H2,1-2H3,(H2,20,24)(H,21,23);3-6H,7,13H2,1-2H3,(H2,12,14);1-5,7H,6H2,(H,9,10)/t17-,19+;11-;/m10./s1 |
| InChIKey | HVDAEXGNOIGOQF-SWHAZEOESA-N |
| XLogP | 3.49 |
| TPSA | 182.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|